C27H29FN4O4 — CID 66991452
N-[[3-[5-[[(2S)-1-amino-2-cyclohexyl-1-oxopropan-2-yl]carbamoyl]furan-2-yl]phenyl]methyl]-2-fluoropyridine-4-carboxamide (PubChem CID 66991452) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is N-[[3-[5-[[(2S)-1-amino-2-cyclohexyl-1-oxopropan-2-yl]carbamoyl]furan-2-yl]phenyl]methyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[[3-[5-[[(2S)-1-amino-2-cyclohexyl-1-oxopropan-2-yl]carbamoyl]furan-2-yl]phenyl]methyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 66991452 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[[3-[5-[[(2S)-1-amino-2-cyclohexyl-1-oxopropan-2-yl]carbamoyl]furan-2-yl]phenyl]methyl]-2-fluoropyridine-4-carboxamide |
| SMILES | C[C@@](NC(=O)c1ccc(-c2cccc(CNC(=O)c3ccnc(F)c3)c2)o1)(C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C27H29FN4O4/c1-27(26(29)35,20-8-3-2-4-9-20)32-25(34)22-11-10-21(36-22)18-7-5-6-17(14-18)16-31-24(33)19-12-13-30-23(28)15-19/h5-7,10-15,20H,2-4,8-9,16H2,1H3,(H2,29,35)(H,31,33)(H,32,34)/t27-/m0/s1 |
| InChIKey | SOEHJAJOQLMUNQ-MHZLTWQESA-N |
| XLogP | 3.96 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|