C12H20ClNO4 — CID 66993248
3-chloro-1-(3,3-dimethylbutoxycarbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 66993248) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is 3-chloro-1-(3,3-dimethylbutoxycarbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 3-chloro-1-(3,3-dimethylbutoxycarbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66993248 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-chloro-1-(3,3-dimethylbutoxycarbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)CCOC(=O)N1CCC(Cl)C1C(=O)O |
| InChI | InChI=1S/C12H20ClNO4/c1-12(2,3)5-7-18-11(17)14-6-4-8(13)9(14)10(15)16/h8-9H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | QZESQHWIJTYYRJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|