C18H31NO5 — CID 174207882
bis(3,3-dimethylbutyl) 3-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 174207882) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is bis(3,3-dimethylbutyl) 3-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | bis(3,3-dimethylbutyl) 3-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174207882 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | bis(3,3-dimethylbutyl) 3-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)CCOC(=O)C1C(=O)CCN1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C18H31NO5/c1-17(2,3)8-11-23-15(21)14-13(20)7-10-19(14)16(22)24-12-9-18(4,5)6/h14H,7-12H2,1-6H3 |
| InChIKey | INPGWBBZHJJVAT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|