C20H25N3OS — CID 66993495
(E)-3-(2,8-dimethyl-1-thia-3,8-diazaspiro[4.5]decan-3-yl)-1-(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 66993495) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is (E)-3-(2,8-dimethyl-1-thia-3,8-diazaspiro[4.5]decan-3-yl)-1-(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,8-dimethyl-1-thia-3,8-diazaspiro[4.5]decan-3-yl)-1-(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66993495 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (E)-3-(2,8-dimethyl-1-thia-3,8-diazaspiro[4.5]decan-3-yl)-1-(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | CC1SC2(CCN(C)CC2)CN1/C=C/C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H25N3OS/c1-15-23(14-20(25-15)8-11-22(2)12-9-20)10-7-19(24)17-13-21-18-6-4-3-5-16(17)18/h3-7,10,13,15,21H,8-9,11-12,14H2,1-2H3/b10-7+ |
| InChIKey | AKCGTAAIPSZHTP-JXMROGBWSA-N |
| XLogP | 3.72 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|