C32H52N2O — CID 66994684
N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-hexylhexan-1-amine (PubChem CID 66994684) has the molecular formula C32H52N2O and a molecular weight of 480.78 g/mol. Its IUPAC name is N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-hexylhexan-1-amine.
| Compound Name | N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-hexylhexan-1-amine |
|---|---|
| PubChem CID | 66994684 |
| Molecular Formula | C32H52N2O |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.41 |
| IUPAC Name | N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-hexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)Cc1c(OC(C)C)cc(-c2c(CC)cccc2CC)nc1C |
| InChI | InChI=1S/C32H52N2O/c1-8-12-14-16-21-34(22-17-15-13-9-2)24-29-26(7)33-30(23-31(29)35-25(5)6)32-27(10-3)19-18-20-28(32)11-4/h18-20,23,25H,8-17,21-22,24H2,1-7H3 |
| InChIKey | FJMDDFWUWBUUBD-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|