C33H46N2O — CID 66994944
N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-(2-phenylethyl)pentan-1-amine (PubChem CID 66994944) has the molecular formula C33H46N2O and a molecular weight of 486.74 g/mol. Its IUPAC name is N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-(2-phenylethyl)pentan-1-amine.
| Compound Name | N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-(2-phenylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 66994944 |
| Molecular Formula | C33H46N2O |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | N-[[6-(2,6-diethylphenyl)-2-methyl-4-propan-2-yloxy-3-pyridinyl]methyl]-N-(2-phenylethyl)pentan-1-amine |
| SMILES | CCCCCN(CCc1ccccc1)Cc1c(OC(C)C)cc(-c2c(CC)cccc2CC)nc1C |
| InChI | InChI=1S/C33H46N2O/c1-7-10-14-21-35(22-20-27-16-12-11-13-17-27)24-30-26(6)34-31(23-32(30)36-25(4)5)33-28(8-2)18-15-19-29(33)9-3/h11-13,15-19,23,25H,7-10,14,20-22,24H2,1-6H3 |
| InChIKey | ZXRWCMJZJSNTBZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|