C30H40N2O — CID 90827308
N-[[6-(2,6-diethylphenyl)-4-methoxy-2-methyl-3-pyridinyl]methyl]-1-phenylhexan-1-amine (PubChem CID 90827308) has the molecular formula C30H40N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is N-[[6-(2,6-diethylphenyl)-4-methoxy-2-methyl-3-pyridinyl]methyl]-1-phenylhexan-1-amine.
| Compound Name | N-[[6-(2,6-diethylphenyl)-4-methoxy-2-methyl-3-pyridinyl]methyl]-1-phenylhexan-1-amine |
|---|---|
| PubChem CID | 90827308 |
| Molecular Formula | C30H40N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | N-[[6-(2,6-diethylphenyl)-4-methoxy-2-methyl-3-pyridinyl]methyl]-1-phenylhexan-1-amine |
| SMILES | CCCCCC(NCc1c(OC)cc(-c2c(CC)cccc2CC)nc1C)c1ccccc1 |
| InChI | InChI=1S/C30H40N2O/c1-6-9-11-19-27(25-15-12-10-13-16-25)31-21-26-22(4)32-28(20-29(26)33-5)30-23(7-2)17-14-18-24(30)8-3/h10,12-18,20,27,31H,6-9,11,19,21H2,1-5H3 |
| InChIKey | PSPKADVPFQNSAN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|