C23H25NO2 — CID 59678346
[6-(2,6-diethylphenyl)-4-methoxy-3-pyridinyl]-phenylmethanol (PubChem CID 59678346) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is [6-(2,6-diethylphenyl)-4-methoxy-3-pyridinyl]-phenylmethanol.
| Compound Name | [6-(2,6-diethylphenyl)-4-methoxy-3-pyridinyl]-phenylmethanol |
|---|---|
| PubChem CID | 59678346 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | [6-(2,6-diethylphenyl)-4-methoxy-3-pyridinyl]-phenylmethanol |
| SMILES | CCc1cccc(CC)c1-c1cc(OC)c(C(O)c2ccccc2)cn1 |
| InChI | InChI=1S/C23H25NO2/c1-4-16-12-9-13-17(5-2)22(16)20-14-21(26-3)19(15-24-20)23(25)18-10-7-6-8-11-18/h6-15,23,25H,4-5H2,1-3H3 |
| InChIKey | NDELXCLHVWPJLW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |