C26H39NO2 — CID 66993793
2-(2,6-diethylphenyl)-4-ethoxy-5-(4-ethoxyheptan-4-yl)pyridine (PubChem CID 66993793) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-4-ethoxy-5-(4-ethoxyheptan-4-yl)pyridine.
| Compound Name | 2-(2,6-diethylphenyl)-4-ethoxy-5-(4-ethoxyheptan-4-yl)pyridine |
|---|---|
| PubChem CID | 66993793 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 2-(2,6-diethylphenyl)-4-ethoxy-5-(4-ethoxyheptan-4-yl)pyridine |
| SMILES | CCCC(CCC)(OCC)c1cnc(-c2c(CC)cccc2CC)cc1OCC |
| InChI | InChI=1S/C26H39NO2/c1-7-16-26(17-8-2,29-12-6)22-19-27-23(18-24(22)28-11-5)25-20(9-3)14-13-15-21(25)10-4/h13-15,18-19H,7-12,16-17H2,1-6H3 |
| InChIKey | QDBFBTCZUHYPSH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |