About 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine
6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine (PubChem CID 66994787) has the molecular formula C27H33NO
and a molecular weight of 387.57 g/mol. Its IUPAC name is 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine.
Molecular Properties
| Compound Name | 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine |
| PubChem CID | 66994787 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine |
| SMILES | CCCc1cccc(OCc2c(C)cc(-c3c(CC)cccc3CC)nc2C)c1 |
| InChI | InChI=1S/C27H33NO/c1-6-11-21-12-9-15-24(17-21)29-18-25-19(4)16-26(28-20(25)5)27-22(7-2)13-10-14-23(27)8-3/h9-10,12-17H,6-8,11,18H2,1-5H3 |
| InChIKey | SFEYATXCRGOWSD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine?
The IUPAC name of 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine (CID 66994787) is 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine.
What is the SMILES notation for 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine?
The canonical SMILES for 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine is CCCc1cccc(OCc2c(C)cc(-c3c(CC)cccc3CC)nc2C)c1.
What is the InChIKey of 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine?
The InChIKey is SFEYATXCRGOWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33NO/c1-6-11-21-12-9-15-24(17-21)29-18-25-19(4)16-26(28-20(25)5)27-22(7-2)13-10-14-23(27)8-3/h9-10,12-17H,6-8,11,18H2,1-5H3.
What are the key properties of 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine?
6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine has a molecular weight of 387.57 g/mol, XLogP of 7.02, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-diethylphenyl)-2,4-dimethyl-3-[(3-propylphenoxy)methyl]pyridine is sourced from PubChem (CID 66994787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).