C30H25F4NO2S — CID 66995462
(3R)-3-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]-3-tritylsulfanylpropanoic acid (PubChem CID 66995462) has the molecular formula C30H25F4NO2S and a molecular weight of 539.59 g/mol. Its IUPAC name is (3R)-3-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]-3-tritylsulfanylpropanoic acid.
| Compound Name | (3R)-3-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 66995462 |
| Molecular Formula | C30H25F4NO2S |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (3R)-3-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]-3-tritylsulfanylpropanoic acid |
| SMILES | O=C(O)C[C@H](N[C@@H](c1ccc(F)cc1)C(F)(F)F)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25F4NO2S/c31-25-18-16-21(17-19-25)28(30(32,33)34)35-26(20-27(36)37)38-29(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-19,26,28,35H,20H2,(H,36,37)/t26-,28+/m1/s1 |
| InChIKey | MOVIJAYPGVGGFF-IAPPQJPRSA-N |
| XLogP | 7.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|