(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid

C10H9F4NO2 — CID 141426113

IUPAC(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid
SMILESO=C(O)C[C@@H](Nc1ccc(F)cc1)C(F)(F)F
InChIInChI=1S/C10H9F4NO2/c11-6-1-3-7(4-2-6)15-8(5-9(16)17)10(12,13)14/h1-4,8,15H,5H2,(H,16,17)/t8-/m1/s1
InChIKeyMXYUTXITEJWNSO-MRVPVSSYSA-N
MW251.18 g/mol
LogP2.64
Rot. Bonds4

About (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid

(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid (PubChem CID 141426113) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid.

Molecular Properties

Compound Name(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid
PubChem CID141426113
Molecular FormulaC10H9F4NO2
Molecular Weight251.18 g/mol
Exact Mass251.06
IUPAC Name(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid
SMILESO=C(O)C[C@@H](Nc1ccc(F)cc1)C(F)(F)F
InChIInChI=1S/C10H9F4NO2/c11-6-1-3-7(4-2-6)15-8(5-9(16)17)10(12,13)14/h1-4,8,15H,5H2,(H,16,17)/t8-/m1/s1
InChIKeyMXYUTXITEJWNSO-MRVPVSSYSA-N
XLogP2.64
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.18
LogP ≤ 52.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid?
The IUPAC name of (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid (CID 141426113) is (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid.
What is the SMILES notation for (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid?
The canonical SMILES for (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid is O=C(O)C[C@@H](Nc1ccc(F)cc1)C(F)(F)F.
What is the InChIKey of (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid?
The InChIKey is MXYUTXITEJWNSO-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H9F4NO2/c11-6-1-3-7(4-2-6)15-8(5-9(16)17)10(12,13)14/h1-4,8,15H,5H2,(H,16,17)/t8-/m1/s1.
What are the key properties of (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid?
(3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid has a molecular weight of 251.18 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4,4-trifluoro-3-(4-fluoroanilino)butanoic acid is sourced from PubChem (CID 141426113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).