C12H14Cl3FN2O2 — CID 3585483
propan-2-yl N-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]carbamate (PubChem CID 3585483) has the molecular formula C12H14Cl3FN2O2 and a molecular weight of 343.61 g/mol. Its IUPAC name is propan-2-yl N-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]carbamate.
| Compound Name | propan-2-yl N-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 3585483 |
| Molecular Formula | C12H14Cl3FN2O2 |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | propan-2-yl N-[2,2,2-trichloro-1-(4-fluoroanilino)ethyl]carbamate |
| SMILES | CC(C)OC(=O)NC(Nc1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H14Cl3FN2O2/c1-7(2)20-11(19)18-10(12(13,14)15)17-9-5-3-8(16)4-6-9/h3-7,10,17H,1-2H3,(H,18,19) |
| InChIKey | PICJRVTYPNGTPI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|