C13H13Cl5N2O4 — CID 71675444
[2,2,2-trichloro-1-(propan-2-yloxycarbonylamino)ethyl] N-(3,4-dichlorophenyl)carbamate (PubChem CID 71675444) has the molecular formula C13H13Cl5N2O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(propan-2-yloxycarbonylamino)ethyl] N-(3,4-dichlorophenyl)carbamate.
| Compound Name | [2,2,2-trichloro-1-(propan-2-yloxycarbonylamino)ethyl] N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 71675444 |
| Molecular Formula | C13H13Cl5N2O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | [2,2,2-trichloro-1-(propan-2-yloxycarbonylamino)ethyl] N-(3,4-dichlorophenyl)carbamate |
| SMILES | CC(C)OC(=O)NC(OC(=O)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl5N2O4/c1-6(2)23-12(22)20-10(13(16,17)18)24-11(21)19-7-3-4-8(14)9(15)5-7/h3-6,10H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | KZKNRQLIMCRRRU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|