2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid

C12H11Cl2NO4 — CID 174279250

IUPAC2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid
SMILESC=C(C)C(OC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H11Cl2NO4/c1-6(2)10(11(16)17)19-12(18)15-7-3-4-8(13)9(14)5-7/h3-5,10H,1H2,2H3,(H,15,18)(H,16,17)
InChIKeyMSJGNXVVNYYHQK-UHFFFAOYSA-N
MW304.13 g/mol
LogP3.57
Rot. Bonds4

About 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid

2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid (PubChem CID 174279250) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid.

Molecular Properties

Compound Name2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid
PubChem CID174279250
Molecular FormulaC12H11Cl2NO4
Molecular Weight304.13 g/mol
Exact Mass303.01
IUPAC Name2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid
SMILESC=C(C)C(OC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O
InChIInChI=1S/C12H11Cl2NO4/c1-6(2)10(11(16)17)19-12(18)15-7-3-4-8(13)9(14)5-7/h3-5,10H,1H2,2H3,(H,15,18)(H,16,17)
InChIKeyMSJGNXVVNYYHQK-UHFFFAOYSA-N
XLogP3.57
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.13
LogP ≤ 53.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid?
The IUPAC name of 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid (CID 174279250) is 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid.
What is the SMILES notation for 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid?
The canonical SMILES for 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid is C=C(C)C(OC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid?
The InChIKey is MSJGNXVVNYYHQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2NO4/c1-6(2)10(11(16)17)19-12(18)15-7-3-4-8(13)9(14)5-7/h3-5,10H,1H2,2H3,(H,15,18)(H,16,17).
What are the key properties of 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid?
2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid has a molecular weight of 304.13 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid is sourced from PubChem (CID 174279250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).