C12H11Cl2NO4 — CID 174279250
2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid (PubChem CID 174279250) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid |
|---|---|
| PubChem CID | 174279250 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoic acid |
| SMILES | C=C(C)C(OC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H11Cl2NO4/c1-6(2)10(11(16)17)19-12(18)15-7-3-4-8(13)9(14)5-7/h3-5,10H,1H2,2H3,(H,15,18)(H,16,17) |
| InChIKey | MSJGNXVVNYYHQK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|