C13H13Cl2NO4 — CID 22150921
methyl 2-[(2,5-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoate (PubChem CID 22150921) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is methyl 2-[(2,5-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoate.
| Compound Name | methyl 2-[(2,5-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 22150921 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | methyl 2-[(2,5-dichlorophenyl)carbamoyloxy]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(OC(=O)Nc1cc(Cl)ccc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H13Cl2NO4/c1-7(2)11(12(17)19-3)20-13(18)16-10-6-8(14)4-5-9(10)15/h4-6,11H,1H2,2-3H3,(H,16,18) |
| InChIKey | FZNKTYONYQKSIP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|