C15H17ClFNO5 — CID 21247440
methyl 2-[(4-chloro-2-fluoro-5-methoxyphenyl)carbamoyloxy]-3-methylidenepentanoate (PubChem CID 21247440) has the molecular formula C15H17ClFNO5 and a molecular weight of 345.75 g/mol. Its IUPAC name is methyl 2-[(4-chloro-2-fluoro-5-methoxyphenyl)carbamoyloxy]-3-methylidenepentanoate.
| Compound Name | methyl 2-[(4-chloro-2-fluoro-5-methoxyphenyl)carbamoyloxy]-3-methylidenepentanoate |
|---|---|
| PubChem CID | 21247440 |
| Molecular Formula | C15H17ClFNO5 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 2-[(4-chloro-2-fluoro-5-methoxyphenyl)carbamoyloxy]-3-methylidenepentanoate |
| SMILES | C=C(CC)C(OC(=O)Nc1cc(OC)c(Cl)cc1F)C(=O)OC |
| InChI | InChI=1S/C15H17ClFNO5/c1-5-8(2)13(14(19)22-4)23-15(20)18-11-7-12(21-3)9(16)6-10(11)17/h6-7,13H,2,5H2,1,3-4H3,(H,18,20) |
| InChIKey | HTMJKVCSZIYOCY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|