C17H11Cl5F3N3O3 — CID 163149557
[(1S)-2,2,2-trichloro-1-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl] N-(3,4-dichlorophenyl)carbamate (PubChem CID 163149557) has the molecular formula C17H11Cl5F3N3O3 and a molecular weight of 539.55 g/mol. Its IUPAC name is [(1S)-2,2,2-trichloro-1-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl] N-(3,4-dichlorophenyl)carbamate.
| Compound Name | [(1S)-2,2,2-trichloro-1-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl] N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 163149557 |
| Molecular Formula | C17H11Cl5F3N3O3 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 536.92 |
| IUPAC Name | [(1S)-2,2,2-trichloro-1-[[3-(trifluoromethyl)phenyl]carbamoylamino]ethyl] N-(3,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N[C@@H](OC(=O)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H11Cl5F3N3O3/c18-11-5-4-10(7-12(11)19)27-15(30)31-13(16(20,21)22)28-14(29)26-9-3-1-2-8(6-9)17(23,24)25/h1-7,13H,(H,27,30)(H2,26,28,29)/t13-/m0/s1 |
| InChIKey | MVIUZDARTHPTEY-ZDUSSCGKSA-N |
| XLogP | 7.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|