About pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate
pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (PubChem CID 66996123) has the molecular formula C21H19F3N4O3
and a molecular weight of 432.40 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| PubChem CID | 66996123 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate |
| SMILES | CC(C)Oc1cc(-c2ncn(C=CC(=O)OCc3ccccn3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N4O3/c1-14(2)31-18-10-15(9-16(11-18)21(22,23)24)20-26-13-28(27-20)8-6-19(29)30-12-17-5-3-4-7-25-17/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | FOCYRGHXVRQHQV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The IUPAC name of pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate (CID 66996123) is pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate.
What is the SMILES notation for pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The canonical SMILES for pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate is CC(C)Oc1cc(-c2ncn(C=CC(=O)OCc3ccccn3)n2)cc(C(F)(F)F)c1.
What is the InChIKey of pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
The InChIKey is FOCYRGHXVRQHQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3N4O3/c1-14(2)31-18-10-15(9-16(11-18)21(22,23)24)20-26-13-28(27-20)8-6-19(29)30-12-17-5-3-4-7-25-17/h3-11,13-14H,12H2,1-2H3.
What are the key properties of pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate?
pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate has a molecular weight of 432.40 g/mol, XLogP of 4.36, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 3-[3-[3-propan-2-yloxy-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoate is sourced from PubChem (CID 66996123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).