C11H16Br2O4 — CID 66996923
[1-(acetyloxymethyl)-2,2-bis(bromomethyl)cyclopropyl]methyl acetate (PubChem CID 66996923) has the molecular formula C11H16Br2O4 and a molecular weight of 372.05 g/mol. Its IUPAC name is [1-(acetyloxymethyl)-2,2-bis(bromomethyl)cyclopropyl]methyl acetate.
| Compound Name | [1-(acetyloxymethyl)-2,2-bis(bromomethyl)cyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 66996923 |
| Molecular Formula | C11H16Br2O4 |
| Molecular Weight | 372.05 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | [1-(acetyloxymethyl)-2,2-bis(bromomethyl)cyclopropyl]methyl acetate |
| SMILES | CC(=O)OCC1(COC(C)=O)CC1(CBr)CBr |
| InChI | InChI=1S/C11H16Br2O4/c1-8(14)16-6-11(7-17-9(2)15)3-10(11,4-12)5-13/h3-7H2,1-2H3 |
| InChIKey | PQZXMFJFWALNBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.05 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|