About CID 59906669
CID 59906669 (PubChem CID 59906669) has the molecular formula C11H19BO3
and a molecular weight of 210.08 g/mol.
Molecular Properties
| Compound Name | CID 59906669 |
| PubChem CID | 59906669 |
| Molecular Formula | C11H19BO3 |
| Molecular Weight | 210.08 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | — |
| SMILES | [B]C1(C)CC(C)(C)C(C)(COC(C)=O)O1 |
| InChI | InChI=1S/C11H19BO3/c1-8(13)14-7-10(4)9(2,3)6-11(5,12)15-10/h6-7H2,1-5H3 |
| InChIKey | GBVUEFSCDCDBTN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.08 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59906669 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59906669?
The IUPAC name of CID 59906669 (CID 59906669) is not available.
What is the SMILES notation for CID 59906669?
The canonical SMILES for CID 59906669 is [B]C1(C)CC(C)(C)C(C)(COC(C)=O)O1.
What is the InChIKey of CID 59906669?
The InChIKey is GBVUEFSCDCDBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BO3/c1-8(13)14-7-10(4)9(2,3)6-11(5,12)15-10/h6-7H2,1-5H3.
What are the key properties of CID 59906669?
CID 59906669 has a molecular weight of 210.08 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59906669 is sourced from PubChem (CID 59906669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).