pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid

C16H18N2O2 — CID 66996995

IUPACpyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid
SMILESCc1cc(C)c(N(Cc2ccncc2)C(=O)O)c(C)c1
InChIInChI=1S/C16H18N2O2/c1-11-8-12(2)15(13(3)9-11)18(16(19)20)10-14-4-6-17-7-5-14/h4-9H,10H2,1-3H3,(H,19,20)
InChIKeyZKYYSKYQUVXNSI-UHFFFAOYSA-N
MW270.33 g/mol
LogP3.69
Rot. Bonds3

About pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid

pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid (PubChem CID 66996995) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid.

Molecular Properties

Compound Namepyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid
PubChem CID66996995
Molecular FormulaC16H18N2O2
Molecular Weight270.33 g/mol
Exact Mass270.14
IUPAC Namepyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid
SMILESCc1cc(C)c(N(Cc2ccncc2)C(=O)O)c(C)c1
InChIInChI=1S/C16H18N2O2/c1-11-8-12(2)15(13(3)9-11)18(16(19)20)10-14-4-6-17-7-5-14/h4-9H,10H2,1-3H3,(H,19,20)
InChIKeyZKYYSKYQUVXNSI-UHFFFAOYSA-N
XLogP3.69
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.33
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid?
The IUPAC name of pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid (CID 66996995) is pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid.
What is the SMILES notation for pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid?
The canonical SMILES for pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid is Cc1cc(C)c(N(Cc2ccncc2)C(=O)O)c(C)c1.
What is the InChIKey of pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid?
The InChIKey is ZKYYSKYQUVXNSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11-8-12(2)15(13(3)9-11)18(16(19)20)10-14-4-6-17-7-5-14/h4-9H,10H2,1-3H3,(H,19,20).
What are the key properties of pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid?
pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid has a molecular weight of 270.33 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-ylmethyl-(2,4,6-trimethylphenyl)carbamic acid is sourced from PubChem (CID 66996995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).