C27H23NO5 — CID 66999408
4-[4-[[2-(2-benzoylphenoxy)acetyl]amino]phenyl]-2,2-dimethylbut-3-ynoic acid (PubChem CID 66999408) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[4-[[2-(2-benzoylphenoxy)acetyl]amino]phenyl]-2,2-dimethylbut-3-ynoic acid.
| Compound Name | 4-[4-[[2-(2-benzoylphenoxy)acetyl]amino]phenyl]-2,2-dimethylbut-3-ynoic acid |
|---|---|
| PubChem CID | 66999408 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[4-[[2-(2-benzoylphenoxy)acetyl]amino]phenyl]-2,2-dimethylbut-3-ynoic acid |
| SMILES | CC(C)(C#Cc1ccc(NC(=O)COc2ccccc2C(=O)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H23NO5/c1-27(2,26(31)32)17-16-19-12-14-21(15-13-19)28-24(29)18-33-23-11-7-6-10-22(23)25(30)20-8-4-3-5-9-20/h3-15H,18H2,1-2H3,(H,28,29)(H,31,32) |
| InChIKey | KHCIYISQMUHMRE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|