C21H16ClN5 — CID 67001026
5-[2-[5-(4-chlorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidin-3-yl]ethynyl]pyridin-2-amine (PubChem CID 67001026) has the molecular formula C21H16ClN5 and a molecular weight of 373.85 g/mol. Its IUPAC name is 5-[2-[5-(4-chlorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidin-3-yl]ethynyl]pyridin-2-amine.
| Compound Name | 5-[2-[5-(4-chlorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidin-3-yl]ethynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 67001026 |
| Molecular Formula | C21H16ClN5 |
| Molecular Weight | 373.85 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-[2-[5-(4-chlorophenyl)-7-ethylpyrazolo[1,5-a]pyrimidin-3-yl]ethynyl]pyridin-2-amine |
| SMILES | CCc1cc(-c2ccc(Cl)cc2)nc2c(C#Cc3ccc(N)nc3)cnn12 |
| InChI | InChI=1S/C21H16ClN5/c1-2-18-11-19(15-6-8-17(22)9-7-15)26-21-16(13-25-27(18)21)5-3-14-4-10-20(23)24-12-14/h4,6-13H,2H2,1H3,(H2,23,24) |
| InChIKey | QZSPDMQZRHHFLW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|