C22H28F3N3O4 — CID 67005103
N-[2-[[(3S,4R)-1-(oxan-4-yl)-4-prop-2-enoxypyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 67005103) has the molecular formula C22H28F3N3O4 and a molecular weight of 455.48 g/mol. Its IUPAC name is N-[2-[[(3S,4R)-1-(oxan-4-yl)-4-prop-2-enoxypyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3S,4R)-1-(oxan-4-yl)-4-prop-2-enoxypyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67005103 |
| Molecular Formula | C22H28F3N3O4 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[2-[[(3S,4R)-1-(oxan-4-yl)-4-prop-2-enoxypyrrolidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | C=CCO[C@@H]1CN(C2CCOCC2)C[C@@H]1NC(=O)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H28F3N3O4/c1-2-8-32-19-14-28(17-6-9-31-10-7-17)13-18(19)27-20(29)12-26-21(30)15-4-3-5-16(11-15)22(23,24)25/h2-5,11,17-19H,1,6-10,12-14H2,(H,26,30)(H,27,29)/t18-,19+/m0/s1 |
| InChIKey | XSVRCTTUNHKLMX-RBUKOAKNSA-N |
| XLogP | 1.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|