C24H30F3N3O3 — CID 77190320
N-[2-[(4-but-2-ynoxy-1-cyclohexylpyrrolidin-3-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 77190320) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is N-[2-[(4-but-2-ynoxy-1-cyclohexylpyrrolidin-3-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(4-but-2-ynoxy-1-cyclohexylpyrrolidin-3-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 77190320 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[2-[(4-but-2-ynoxy-1-cyclohexylpyrrolidin-3-yl)amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC#CCOC1CN(C2CCCCC2)CC1NC(=O)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H30F3N3O3/c1-2-3-12-33-21-16-30(19-10-5-4-6-11-19)15-20(21)29-22(31)14-28-23(32)17-8-7-9-18(13-17)24(25,26)27/h7-9,13,19-21H,4-6,10-12,14-16H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | ZZYOZDJMZZYQBF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|