About 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid
3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid (PubChem CID 67005635) has the molecular formula C22H23FN2O2
and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid.
Molecular Properties
| Compound Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid |
| PubChem CID | 67005635 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid |
| SMILES | CC(C)C=C(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C22H23FN2O2/c1-14(2)11-19(22(3,4)21(26)27)15-5-10-20-16(12-15)13-24-25(20)18-8-6-17(23)7-9-18/h5-14H,1-4H3,(H,26,27) |
| InChIKey | WAIATZHYHHAKQR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid?
The IUPAC name of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid (CID 67005635) is 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid.
What is the SMILES notation for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid?
The canonical SMILES for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid is CC(C)C=C(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(C)(C)C(=O)O.
What is the InChIKey of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid?
The InChIKey is WAIATZHYHHAKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN2O2/c1-14(2)11-19(22(3,4)21(26)27)15-5-10-20-16(12-15)13-24-25(20)18-8-6-17(23)7-9-18/h5-14H,1-4H3,(H,26,27).
What are the key properties of 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid?
3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid has a molecular weight of 366.44 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-fluorophenyl)indazol-5-yl]-2,2,5-trimethylhex-3-enoic acid is sourced from PubChem (CID 67005635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).