C34H30Cl2N8OS — CID 67005935
2,6-dichloro-N-[3-[5-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide (PubChem CID 67005935) has the molecular formula C34H30Cl2N8OS and a molecular weight of 669.64 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-[5-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-[5-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 67005935 |
| Molecular Formula | C34H30Cl2N8OS |
| Molecular Weight | 669.64 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 2,6-dichloro-N-[3-[5-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(Nc3nccc(-c4c(-c5cccc(NC(=O)c6c(Cl)cccc6Cl)c5)nc5sccn45)n3)cc2)CC1 |
| InChI | InChI=1S/C34H30Cl2N8OS/c1-2-42-15-17-43(18-16-42)25-11-9-23(10-12-25)39-33-37-14-13-28(40-33)31-30(41-34-44(31)19-20-46-34)22-5-3-6-24(21-22)38-32(45)29-26(35)7-4-8-27(29)36/h3-14,19-21H,2,15-18H2,1H3,(H,38,45)(H,37,39,40) |
| InChIKey | ZGTYILMJPSUAPT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|