C33H29N7O4S — CID 67006011
(4-methoxyphenyl) N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamate (PubChem CID 67006011) has the molecular formula C33H29N7O4S and a molecular weight of 619.71 g/mol. Its IUPAC name is (4-methoxyphenyl) N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamate.
| Compound Name | (4-methoxyphenyl) N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 67006011 |
| Molecular Formula | C33H29N7O4S |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | (4-methoxyphenyl) N-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]carbamate |
| SMILES | COc1ccc(OC(=O)Nc2cccc(-c3nc4sccn4c3-c3ccnc(Nc4ccc(N5CCOCC5)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C33H29N7O4S/c1-42-26-9-11-27(12-10-26)44-33(41)36-24-4-2-3-22(21-24)29-30(40-17-20-45-32(40)38-29)28-13-14-34-31(37-28)35-23-5-7-25(8-6-23)39-15-18-43-19-16-39/h2-14,17,20-21H,15-16,18-19H2,1H3,(H,36,41)(H,34,35,37) |
| InChIKey | HAUUPCYUFFJGEI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|