C32H27N7O2S — CID 87234279
N-(3-morpholin-4-ylphenyl)-4-[6-[3-[(E)-phenoxyiminomethyl]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 87234279) has the molecular formula C32H27N7O2S and a molecular weight of 573.68 g/mol. Its IUPAC name is N-(3-morpholin-4-ylphenyl)-4-[6-[3-[(E)-phenoxyiminomethyl]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-(3-morpholin-4-ylphenyl)-4-[6-[3-[(E)-phenoxyiminomethyl]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 87234279 |
| Molecular Formula | C32H27N7O2S |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | N-(3-morpholin-4-ylphenyl)-4-[6-[3-[(E)-phenoxyiminomethyl]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | C(=N/Oc1ccccc1)\c1cccc(-c2nc3sccn3c2-c2ccnc(Nc3cccc(N4CCOCC4)c3)n2)c1 |
| InChI | InChI=1S/C32H27N7O2S/c1-2-10-27(11-3-1)41-34-22-23-6-4-7-24(20-23)29-30(39-16-19-42-32(39)37-29)28-12-13-33-31(36-28)35-25-8-5-9-26(21-25)38-14-17-40-18-15-38/h1-13,16,19-22H,14-15,17-18H2,(H,33,35,36)/b34-22+ |
| InChIKey | LHYXSCJWERYAJR-PPOKSSTKSA-N |
| XLogP | 6.51 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|