C18H16FN5O2 — CID 67007882
2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)pyridine-3-carboxylic acid (PubChem CID 67007882) has the molecular formula C18H16FN5O2 and a molecular weight of 353.36 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67007882 |
| Molecular Formula | C18H16FN5O2 |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)pyridine-3-carboxylic acid |
| SMILES | CC(Nc1nc(Nc2cnccn2)ccc1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN5O2/c1-11(12-2-4-13(19)5-3-12)22-17-14(18(25)26)6-7-15(24-17)23-16-10-20-8-9-21-16/h2-11H,1H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | JUHCLEWGKKUIDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |