About 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine
3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 67008396) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 67008396 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)c1cnn2c(N)ccnc12 |
| InChI | InChI=1S/C9H12N4/c1-6(2)7-5-12-13-8(10)3-4-11-9(7)13/h3-6H,10H2,1-2H3 |
| InChIKey | HKCFPVWPHDDWDB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine (CID 67008396) is 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine is CC(C)c1cnn2c(N)ccnc12.
What is the InChIKey of 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is HKCFPVWPHDDWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-6(2)7-5-12-13-8(10)3-4-11-9(7)13/h3-6H,10H2,1-2H3.
What are the key properties of 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine?
3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 176.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 67008396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).