C10H19BO2 — CID 67008889
4,4,5,5-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane (PubChem CID 67008889) has the molecular formula C10H19BO2 and a molecular weight of 182.07 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 67008889 |
| Molecular Formula | C10H19BO2 |
| Molecular Weight | 182.07 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane |
| SMILES | C[C@@H]1C[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H19BO2/c1-7-6-8(7)11-12-9(2,3)10(4,5)13-11/h7-8H,6H2,1-5H3/t7-,8-/m1/s1 |
| InChIKey | TUXCUWZCFQDMLZ-HTQZYQBOSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|