C17H25N5O4 — CID 67008977
3,4-bis(4-methylpiperazin-1-yl)-2-nitrobenzoic acid (PubChem CID 67008977) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3,4-bis(4-methylpiperazin-1-yl)-2-nitrobenzoic acid.
| Compound Name | 3,4-bis(4-methylpiperazin-1-yl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 67008977 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3,4-bis(4-methylpiperazin-1-yl)-2-nitrobenzoic acid |
| SMILES | CN1CCN(c2ccc(C(=O)O)c([N+](=O)[O-])c2N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C17H25N5O4/c1-18-5-9-20(10-6-18)14-4-3-13(17(23)24)15(22(25)26)16(14)21-11-7-19(2)8-12-21/h3-4H,5-12H2,1-2H3,(H,23,24) |
| InChIKey | FOTWCSKHVBHSHL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|