C30H30FN7O7S — CID 67010551
N-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)-1-[4-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]cyclohexyl]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 67010551) has the molecular formula C30H30FN7O7S and a molecular weight of 651.68 g/mol. Its IUPAC name is N-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)-1-[4-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]cyclohexyl]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)-1-[4-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]cyclohexyl]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67010551 |
| Molecular Formula | C30H30FN7O7S |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | N-[2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)-1-[4-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]cyclohexyl]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | O=C1COc2ccc(CNC3CCC(C(Cn4c(=O)ccc5ncc(F)cc54)NS(=O)(=O)c4ccccc4[N+](=O)[O-])CC3)nc2N1 |
| InChI | InChI=1S/C30H30FN7O7S/c31-19-13-25-22(33-14-19)10-12-29(40)37(25)16-23(36-46(43,44)27-4-2-1-3-24(27)38(41)42)18-5-7-20(8-6-18)32-15-21-9-11-26-30(34-21)35-28(39)17-45-26/h1-4,9-14,18,20,23,32,36H,5-8,15-17H2,(H,34,35,39) |
| InChIKey | PCEYUZFMTVRXBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 187.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|