C22H24FN5O5S — CID 67010768
N-[1-(4-aminocyclohexyl)-2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 67010768) has the molecular formula C22H24FN5O5S and a molecular weight of 489.53 g/mol. Its IUPAC name is N-[1-(4-aminocyclohexyl)-2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[1-(4-aminocyclohexyl)-2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67010768 |
| Molecular Formula | C22H24FN5O5S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-[1-(4-aminocyclohexyl)-2-(7-fluoro-2-oxo-1,5-naphthyridin-1-yl)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | NC1CCC(C(Cn2c(=O)ccc3ncc(F)cc32)NS(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H24FN5O5S/c23-15-11-20-17(25-12-15)9-10-22(29)27(20)13-18(14-5-7-16(24)8-6-14)26-34(32,33)21-4-2-1-3-19(21)28(30)31/h1-4,9-12,14,16,18,26H,5-8,13,24H2 |
| InChIKey | ORCLUOBXRSFGMG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|