C29H23Cl2N3O2 — CID 67013306
3-[4-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]phenyl]-1-quinolin-2-ylprop-2-en-1-one (PubChem CID 67013306) has the molecular formula C29H23Cl2N3O2 and a molecular weight of 516.43 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]phenyl]-1-quinolin-2-ylprop-2-en-1-one.
| Compound Name | 3-[4-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]phenyl]-1-quinolin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 67013306 |
| Molecular Formula | C29H23Cl2N3O2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 3-[4-[4-(2,3-dichlorophenyl)piperazine-1-carbonyl]phenyl]-1-quinolin-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(C(=O)N2CCN(c3cccc(Cl)c3Cl)CC2)cc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C29H23Cl2N3O2/c30-23-5-3-7-26(28(23)31)33-16-18-34(19-17-33)29(36)22-11-8-20(9-12-22)10-15-27(35)25-14-13-21-4-1-2-6-24(21)32-25/h1-15H,16-19H2 |
| InChIKey | VYZVSORIEHCLKE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|