C24H19N3O2 — CID 67013506
3-[4-(3,5-dimethylpyrazole-1-carbonyl)phenyl]-1-quinolin-2-ylprop-2-en-1-one (PubChem CID 67013506) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylpyrazole-1-carbonyl)phenyl]-1-quinolin-2-ylprop-2-en-1-one.
| Compound Name | 3-[4-(3,5-dimethylpyrazole-1-carbonyl)phenyl]-1-quinolin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 67013506 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-[4-(3,5-dimethylpyrazole-1-carbonyl)phenyl]-1-quinolin-2-ylprop-2-en-1-one |
| SMILES | Cc1cc(C)n(C(=O)c2ccc(C=CC(=O)c3ccc4ccccc4n3)cc2)n1 |
| InChI | InChI=1S/C24H19N3O2/c1-16-15-17(2)27(26-16)24(29)20-10-7-18(8-11-20)9-14-23(28)22-13-12-19-5-3-4-6-21(19)25-22/h3-15H,1-2H3 |
| InChIKey | DTELXVRBXJVWKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|