C35H39N3O5 — CID 6701379
2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6701379) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6701379 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | 2-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc([C@H]2O[C@@H](CN3CCC[C@H]3CN3CCCC3)C[C@@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C35H39N3O5/c39-23-24-12-14-25(15-13-24)32-20-29(22-37-18-6-9-28(37)21-36-16-3-4-17-36)42-35(43-32)26-7-5-8-27(19-26)38-33(40)30-10-1-2-11-31(30)34(38)41/h1-2,5,7-8,10-15,19,28-29,32,35,39H,3-4,6,9,16-18,20-23H2/t28-,29+,32-,35-/m0/s1 |
| InChIKey | RMWHZHOLFUJAKL-PGKIGNJSSA-N |
| XLogP | 5.09 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|