C26H27N3O3 — CID 67014201
ethyl N-[4-[3-(4-piperidin-1-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate (PubChem CID 67014201) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl N-[4-[3-(4-piperidin-1-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[3-(4-piperidin-1-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67014201 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | ethyl N-[4-[3-(4-piperidin-1-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(C(=O)C=Cc2cc(N3CCCCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-2-32-26(31)28-20-12-10-19(11-13-20)25(30)15-14-21-18-24(29-16-6-3-7-17-29)22-8-4-5-9-23(22)27-21/h4-5,8-15,18H,2-3,6-7,16-17H2,1H3,(H,28,31) |
| InChIKey | PJOGOMRNMMDQAR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|