C28H27ClN4O4 — CID 67014343
2-[benzyl(methyl)amino]-4-(2-chlorophenyl)-N-[3-(3,4-dihydroxyphenyl)-3-hydroxypropyl]pyrimidine-5-carboxamide (PubChem CID 67014343) has the molecular formula C28H27ClN4O4 and a molecular weight of 519.00 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-4-(2-chlorophenyl)-N-[3-(3,4-dihydroxyphenyl)-3-hydroxypropyl]pyrimidine-5-carboxamide.
| Compound Name | 2-[benzyl(methyl)amino]-4-(2-chlorophenyl)-N-[3-(3,4-dihydroxyphenyl)-3-hydroxypropyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67014343 |
| Molecular Formula | C28H27ClN4O4 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 2-[benzyl(methyl)amino]-4-(2-chlorophenyl)-N-[3-(3,4-dihydroxyphenyl)-3-hydroxypropyl]pyrimidine-5-carboxamide |
| SMILES | CN(Cc1ccccc1)c1ncc(C(=O)NCCC(O)c2ccc(O)c(O)c2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C28H27ClN4O4/c1-33(17-18-7-3-2-4-8-18)28-31-16-21(26(32-28)20-9-5-6-10-22(20)29)27(37)30-14-13-23(34)19-11-12-24(35)25(36)15-19/h2-12,15-16,23,34-36H,13-14,17H2,1H3,(H,30,37) |
| InChIKey | HOVMLAUIFIRLFA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|