C8H18N2 — CID 67021542
1-ethylcyclohexane-1,2-diamine (PubChem CID 67021542) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-ethylcyclohexane-1,2-diamine.
| Compound Name | 1-ethylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 67021542 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-ethylcyclohexane-1,2-diamine |
| SMILES | CCC1(N)CCCCC1N |
| InChI | InChI=1S/C8H18N2/c1-2-8(10)6-4-3-5-7(8)9/h7H,2-6,9-10H2,1H3 |
| InChIKey | MVASGNRQYLESCQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |