C12H16BrNO3S — CID 67025456
1-amino-2-(3-bromophenyl)-4-methyl-1-oxopentane-2-sulfinic acid (PubChem CID 67025456) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is 1-amino-2-(3-bromophenyl)-4-methyl-1-oxopentane-2-sulfinic acid.
| Compound Name | 1-amino-2-(3-bromophenyl)-4-methyl-1-oxopentane-2-sulfinic acid |
|---|---|
| PubChem CID | 67025456 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 1-amino-2-(3-bromophenyl)-4-methyl-1-oxopentane-2-sulfinic acid |
| SMILES | CC(C)CC(C(N)=O)(c1cccc(Br)c1)S(=O)O |
| InChI | InChI=1S/C12H16BrNO3S/c1-8(2)7-12(11(14)15,18(16)17)9-4-3-5-10(13)6-9/h3-6,8H,7H2,1-2H3,(H2,14,15)(H,16,17) |
| InChIKey | USOIBBDCISSHEV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|