C26H28N2O4 — CID 67028180
2-[[2-cyclopropyl-1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]methylidene]-6-hydroxy-1-benzofuran-3-one (PubChem CID 67028180) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[[2-cyclopropyl-1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]methylidene]-6-hydroxy-1-benzofuran-3-one.
| Compound Name | 2-[[2-cyclopropyl-1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]methylidene]-6-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 67028180 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[[2-cyclopropyl-1-[3-(dimethylamino)propyl]-5-methoxyindol-3-yl]methylidene]-6-hydroxy-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1)c(C=C1Oc3cc(O)ccc3C1=O)c(C1CC1)n2CCCN(C)C |
| InChI | InChI=1S/C26H28N2O4/c1-27(2)11-4-12-28-22-10-8-18(31-3)14-20(22)21(25(28)16-5-6-16)15-24-26(30)19-9-7-17(29)13-23(19)32-24/h7-10,13-16,29H,4-6,11-12H2,1-3H3 |
| InChIKey | VLTIHSPHAXHOOR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|