C22H20ClNO4 — CID 69003224
(2Z)-2-[[1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]methylidene]-4-hydroxy-1-benzofuran-3-one (PubChem CID 69003224) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is (2Z)-2-[[1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]methylidene]-4-hydroxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[[1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]methylidene]-4-hydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69003224 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2Z)-2-[[1-(3-chloropropyl)-5-methoxy-2-methylindol-3-yl]methylidene]-4-hydroxy-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1)c(/C=C1\Oc3cccc(O)c3C1=O)c(C)n2CCCCl |
| InChI | InChI=1S/C22H20ClNO4/c1-13-15(12-20-22(26)21-18(25)5-3-6-19(21)28-20)16-11-14(27-2)7-8-17(16)24(13)10-4-9-23/h3,5-8,11-12,25H,4,9-10H2,1-2H3/b20-12- |
| InChIKey | UESKINYCXDVOHC-NDENLUEZSA-N |
| XLogP | 4.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|