C30H21NO4 — CID 67028348
2-[(1-benzyl-2-phenylindol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one (PubChem CID 67028348) has the molecular formula C30H21NO4 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[(1-benzyl-2-phenylindol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one.
| Compound Name | 2-[(1-benzyl-2-phenylindol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 67028348 |
| Molecular Formula | C30H21NO4 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[(1-benzyl-2-phenylindol-3-yl)methylidene]-4,6-dihydroxy-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2c(-c3ccccc3)n(Cc3ccccc3)c3ccccc23)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C30H21NO4/c32-21-15-25(33)28-26(16-21)35-27(30(28)34)17-23-22-13-7-8-14-24(22)31(18-19-9-3-1-4-10-19)29(23)20-11-5-2-6-12-20/h1-17,32-33H,18H2 |
| InChIKey | RVEXWSJPHNSSGZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|