C11H7Cl2FN2 — CID 67028539
4-[(2,3-dichlorophenyl)-fluoromethyl]pyrimidine (PubChem CID 67028539) has the molecular formula C11H7Cl2FN2 and a molecular weight of 257.10 g/mol. Its IUPAC name is 4-[(2,3-dichlorophenyl)-fluoromethyl]pyrimidine.
| Compound Name | 4-[(2,3-dichlorophenyl)-fluoromethyl]pyrimidine |
|---|---|
| PubChem CID | 67028539 |
| Molecular Formula | C11H7Cl2FN2 |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 4-[(2,3-dichlorophenyl)-fluoromethyl]pyrimidine |
| SMILES | FC(c1ccncn1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl2FN2/c12-8-3-1-2-7(10(8)13)11(14)9-4-5-15-6-16-9/h1-6,11H |
| InChIKey | NGQRNSIGQFPUNE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |