C22H17Cl4N3O — CID 67029660
3-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide (PubChem CID 67029660) has the molecular formula C22H17Cl4N3O and a molecular weight of 481.21 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 67029660 |
| Molecular Formula | C22H17Cl4N3O |
| Molecular Weight | 481.21 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1nn(-c2ccc(Cl)cc2Cl)c2c1C1CCC2C1 |
| InChI | InChI=1S/C22H17Cl4N3O/c23-14-4-3-13(16(25)8-14)10-27-22(30)20-19-11-1-2-12(7-11)21(19)29(28-20)18-6-5-15(24)9-17(18)26/h3-6,8-9,11-12H,1-2,7,10H2,(H,27,30) |
| InChIKey | PRZJFIRVIVPHFK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.21 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |