C41H43N3O9 — CID 6703030
benzyl N-[1-[3-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6703030) has the molecular formula C41H43N3O9 and a molecular weight of 721.81 g/mol. Its IUPAC name is benzyl N-[1-[3-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[3-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6703030 |
| Molecular Formula | C41H43N3O9 |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | benzyl N-[1-[3-[(2R,4R,6S)-4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | COc1cc2c(cc1OC)CN(C[C@H]1C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(N4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)c3)O1)CC2 |
| InChI | InChI=1S/C41H43N3O9/c1-49-36-18-29-15-16-43(22-31(29)19-37(36)50-2)23-33-20-35(28-13-11-26(24-45)12-14-28)53-40(52-33)30-9-6-10-32(17-30)44-38(46)21-34(39(44)47)42-41(48)51-25-27-7-4-3-5-8-27/h3-14,17-19,33-35,40,45H,15-16,20-25H2,1-2H3,(H,42,48)/t33-,34?,35+,40+/m1/s1 |
| InChIKey | ABJCQOHWYZMYKC-LVLCOERNSA-N |
| XLogP | 5.36 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|