C9H16N2 — CID 67031179
2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[2,3-d]azepine (PubChem CID 67031179) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[2,3-d]azepine.
| Compound Name | 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 67031179 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,3,4,4a,5,6,7,9a-octahydro-1H-pyrido[2,3-d]azepine |
| SMILES | C1=CC2NCCCC2CCN1 |
| InChI | InChI=1S/C9H16N2/c1-2-8-3-6-10-7-4-9(8)11-5-1/h4,7-11H,1-3,5-6H2 |
| InChIKey | XFQRAXITTFAWGU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |